C23H27BrN4O5S — CID 44564406
6-bromo-2-[(4-but-2-ynoxyphenyl)sulfonyl-methylamino]-N-hydroxy-3-(4-methylpiperazin-1-yl)benzamide (PubChem CID 44564406) has the molecular formula C23H27BrN4O5S and a molecular weight of 551.46 g/mol. Its IUPAC name is 6-bromo-2-[(4-but-2-ynoxyphenyl)sulfonyl-methylamino]-N-hydroxy-3-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | 6-bromo-2-[(4-but-2-ynoxyphenyl)sulfonyl-methylamino]-N-hydroxy-3-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 44564406 |
| Molecular Formula | C23H27BrN4O5S |
| Molecular Weight | 551.46 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | 6-bromo-2-[(4-but-2-ynoxyphenyl)sulfonyl-methylamino]-N-hydroxy-3-(4-methylpiperazin-1-yl)benzamide |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N(C)c2c(N3CCN(C)CC3)ccc(Br)c2C(=O)NO)cc1 |
| InChI | InChI=1S/C23H27BrN4O5S/c1-4-5-16-33-17-6-8-18(9-7-17)34(31,32)27(3)22-20(28-14-12-26(2)13-15-28)11-10-19(24)21(22)23(29)25-30/h6-11,30H,12-16H2,1-3H3,(H,25,29) |
| InChIKey | AVPJZTNLOKMJMG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|