C23H34ClN3O5S — CID 22644798
2-[(4-but-2-ynoxyphenyl)sulfonyl-[4-(diethylamino)but-2-ynyl]amino]-N-hydroxy-3-methylbutanamide;hydrochloride (PubChem CID 22644798) has the molecular formula C23H34ClN3O5S and a molecular weight of 500.06 g/mol. Its IUPAC name is 2-[(4-but-2-ynoxyphenyl)sulfonyl-[4-(diethylamino)but-2-ynyl]amino]-N-hydroxy-3-methylbutanamide;hydrochloride.
| Compound Name | 2-[(4-but-2-ynoxyphenyl)sulfonyl-[4-(diethylamino)but-2-ynyl]amino]-N-hydroxy-3-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 22644798 |
| Molecular Formula | C23H34ClN3O5S |
| Molecular Weight | 500.06 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 2-[(4-but-2-ynoxyphenyl)sulfonyl-[4-(diethylamino)but-2-ynyl]amino]-N-hydroxy-3-methylbutanamide;hydrochloride |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N(CC#CCN(CC)CC)C(C(=O)NO)C(C)C)cc1.Cl |
| InChI | InChI=1S/C23H33N3O5S.ClH/c1-6-9-18-31-20-12-14-21(15-13-20)32(29,30)26(22(19(4)5)23(27)24-28)17-11-10-16-25(7-2)8-3;/h12-15,19,22,28H,7-8,16-18H2,1-5H3,(H,24,27);1H |
| InChIKey | GGDYFQBUQITYHZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.06 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|