C14H23N3O5S — CID 144510795
(2R)-2-[2-aminoethyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3-methylbutanamide (PubChem CID 144510795) has the molecular formula C14H23N3O5S and a molecular weight of 345.42 g/mol. Its IUPAC name is (2R)-2-[2-aminoethyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3-methylbutanamide.
| Compound Name | (2R)-2-[2-aminoethyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3-methylbutanamide |
|---|---|
| PubChem CID | 144510795 |
| Molecular Formula | C14H23N3O5S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | (2R)-2-[2-aminoethyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3-methylbutanamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCN)[C@@H](C(=O)NO)C(C)C)cc1 |
| InChI | InChI=1S/C14H23N3O5S/c1-10(2)13(14(18)16-19)17(9-8-15)23(20,21)12-6-4-11(22-3)5-7-12/h4-7,10,13,19H,8-9,15H2,1-3H3,(H,16,18)/t13-/m1/s1 |
| InChIKey | ZJKWDGCSASCOTC-CYBMUJFWSA-N |
| XLogP | 0.17 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|