C19H31ClN4O6S — CID 174427091
(2R)-N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(3-oxo-3-piperazin-1-ylpropyl)amino]-3-methylbutanamide;hydrochloride (PubChem CID 174427091) has the molecular formula C19H31ClN4O6S and a molecular weight of 479.00 g/mol. Its IUPAC name is (2R)-N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(3-oxo-3-piperazin-1-ylpropyl)amino]-3-methylbutanamide;hydrochloride.
| Compound Name | (2R)-N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(3-oxo-3-piperazin-1-ylpropyl)amino]-3-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 174427091 |
| Molecular Formula | C19H31ClN4O6S |
| Molecular Weight | 479.00 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | (2R)-N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(3-oxo-3-piperazin-1-ylpropyl)amino]-3-methylbutanamide;hydrochloride |
| SMILES | COc1ccc(S(=O)(=O)N(CCC(=O)N2CCNCC2)[C@@H](C(=O)NO)C(C)C)cc1.Cl |
| InChI | InChI=1S/C19H30N4O6S.ClH/c1-14(2)18(19(25)21-26)23(11-8-17(24)22-12-9-20-10-13-22)30(27,28)16-6-4-15(29-3)5-7-16;/h4-7,14,18,20,26H,8-13H2,1-3H3,(H,21,25);1H/t18-;/m1./s1 |
| InChIKey | DLZQPFOWPPHPIL-GMUIIQOCSA-N |
| XLogP | 0.46 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.00 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|