C20H30N4O8S — CID 57290520
4-[3-[[1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-(4-methoxyphenyl)sulfonylamino]propanoyl]piperazine-1-carboxylic acid (PubChem CID 57290520) has the molecular formula C20H30N4O8S and a molecular weight of 486.55 g/mol. Its IUPAC name is 4-[3-[[1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-(4-methoxyphenyl)sulfonylamino]propanoyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[3-[[1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-(4-methoxyphenyl)sulfonylamino]propanoyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 57290520 |
| Molecular Formula | C20H30N4O8S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 4-[3-[[1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-(4-methoxyphenyl)sulfonylamino]propanoyl]piperazine-1-carboxylic acid |
| SMILES | COc1ccc(S(=O)(=O)N(CCC(=O)N2CCN(C(=O)O)CC2)C(C(=O)NO)C(C)C)cc1 |
| InChI | InChI=1S/C20H30N4O8S/c1-14(2)18(19(26)21-29)24(33(30,31)16-6-4-15(32-3)5-7-16)9-8-17(25)22-10-12-23(13-11-22)20(27)28/h4-7,14,18,29H,8-13H2,1-3H3,(H,21,26)(H,27,28) |
| InChIKey | QRKOLQGMRCUTBR-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 156.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|