C22H36N4O6S — CID 22121984
2-[[3-[4-(dimethylamino)piperidin-1-yl]-3-oxopropyl]-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3-methylbutanamide (PubChem CID 22121984) has the molecular formula C22H36N4O6S and a molecular weight of 484.62 g/mol. Its IUPAC name is 2-[[3-[4-(dimethylamino)piperidin-1-yl]-3-oxopropyl]-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3-methylbutanamide.
| Compound Name | 2-[[3-[4-(dimethylamino)piperidin-1-yl]-3-oxopropyl]-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3-methylbutanamide |
|---|---|
| PubChem CID | 22121984 |
| Molecular Formula | C22H36N4O6S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 2-[[3-[4-(dimethylamino)piperidin-1-yl]-3-oxopropyl]-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3-methylbutanamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCC(=O)N2CCC(N(C)C)CC2)C(C(=O)NO)C(C)C)cc1 |
| InChI | InChI=1S/C22H36N4O6S/c1-16(2)21(22(28)23-29)26(33(30,31)19-8-6-18(32-5)7-9-19)15-12-20(27)25-13-10-17(11-14-25)24(3)4/h6-9,16-17,21,29H,10-15H2,1-5H3,(H,23,28) |
| InChIKey | QNNAUWITTHMABY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|