C21H31N3O8S — CID 174422785
1-[3-[[1-(hydroxyamino)-2-methyl-4-oxobutyl]-(4-methoxyphenyl)sulfonylamino]propanoyl]piperidine-4-carboxylic acid (PubChem CID 174422785) has the molecular formula C21H31N3O8S and a molecular weight of 485.56 g/mol. Its IUPAC name is 1-[3-[[1-(hydroxyamino)-2-methyl-4-oxobutyl]-(4-methoxyphenyl)sulfonylamino]propanoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[3-[[1-(hydroxyamino)-2-methyl-4-oxobutyl]-(4-methoxyphenyl)sulfonylamino]propanoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 174422785 |
| Molecular Formula | C21H31N3O8S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 1-[3-[[1-(hydroxyamino)-2-methyl-4-oxobutyl]-(4-methoxyphenyl)sulfonylamino]propanoyl]piperidine-4-carboxylic acid |
| SMILES | COc1ccc(S(=O)(=O)N(CCC(=O)N2CCC(C(=O)O)CC2)C(NO)C(C)CC=O)cc1 |
| InChI | InChI=1S/C21H31N3O8S/c1-15(10-14-25)20(22-29)24(33(30,31)18-5-3-17(32-2)4-6-18)13-9-19(26)23-11-7-16(8-12-23)21(27)28/h3-6,14-16,20,22,29H,7-13H2,1-2H3,(H,27,28) |
| InChIKey | VRZKUNOBVMNKDX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|