C30H48N4O8S — CID 57181809
tert-butyl N-[[1-[3-[[3-cyclohexyl-1-(hydroxyamino)-1-oxopropan-2-yl]-(4-methoxyphenyl)sulfonylamino]propanoyl]piperidin-4-yl]methyl]carbamate (PubChem CID 57181809) has the molecular formula C30H48N4O8S and a molecular weight of 624.80 g/mol. Its IUPAC name is tert-butyl N-[[1-[3-[[3-cyclohexyl-1-(hydroxyamino)-1-oxopropan-2-yl]-(4-methoxyphenyl)sulfonylamino]propanoyl]piperidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[3-[[3-cyclohexyl-1-(hydroxyamino)-1-oxopropan-2-yl]-(4-methoxyphenyl)sulfonylamino]propanoyl]piperidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 57181809 |
| Molecular Formula | C30H48N4O8S |
| Molecular Weight | 624.80 g/mol |
| Exact Mass | 624.32 |
| IUPAC Name | tert-butyl N-[[1-[3-[[3-cyclohexyl-1-(hydroxyamino)-1-oxopropan-2-yl]-(4-methoxyphenyl)sulfonylamino]propanoyl]piperidin-4-yl]methyl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(CCC(=O)N2CCC(CNC(=O)OC(C)(C)C)CC2)C(CC2CCCCC2)C(=O)NO)cc1 |
| InChI | InChI=1S/C30H48N4O8S/c1-30(2,3)42-29(37)31-21-23-14-17-33(18-15-23)27(35)16-19-34(43(39,40)25-12-10-24(41-4)11-13-25)26(28(36)32-38)20-22-8-6-5-7-9-22/h10-13,22-23,26,38H,5-9,14-21H2,1-4H3,(H,31,37)(H,32,36) |
| InChIKey | HSYPVXMFPNQEIT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 154.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.80 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|