C18H28N2O7S — CID 10597997
tert-butyl N-[1-(hydroxyamino)-4-methyl-1-oxopentan-2-yl]-N-(4-methoxyphenyl)sulfonylcarbamate (PubChem CID 10597997) has the molecular formula C18H28N2O7S and a molecular weight of 416.50 g/mol. Its IUPAC name is tert-butyl N-[1-(hydroxyamino)-4-methyl-1-oxopentan-2-yl]-N-(4-methoxyphenyl)sulfonylcarbamate.
| Compound Name | tert-butyl N-[1-(hydroxyamino)-4-methyl-1-oxopentan-2-yl]-N-(4-methoxyphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 10597997 |
| Molecular Formula | C18H28N2O7S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | tert-butyl N-[1-(hydroxyamino)-4-methyl-1-oxopentan-2-yl]-N-(4-methoxyphenyl)sulfonylcarbamate |
| SMILES | COc1ccc(S(=O)(=O)N(C(=O)OC(C)(C)C)C(CC(C)C)C(=O)NO)cc1 |
| InChI | InChI=1S/C18H28N2O7S/c1-12(2)11-15(16(21)19-23)20(17(22)27-18(3,4)5)28(24,25)14-9-7-13(26-6)8-10-14/h7-10,12,15,23H,11H2,1-6H3,(H,19,21) |
| InChIKey | RBFALCZXPROMIB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|