C25H32N2O8S — CID 11827451
tert-butyl (2S)-2-[[2-(4-methoxyphenyl)-2-oxoethyl]-(4-nitrophenyl)sulfonylamino]-4-methylpentanoate (PubChem CID 11827451) has the molecular formula C25H32N2O8S and a molecular weight of 520.60 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[2-(4-methoxyphenyl)-2-oxoethyl]-(4-nitrophenyl)sulfonylamino]-4-methylpentanoate.
| Compound Name | tert-butyl (2S)-2-[[2-(4-methoxyphenyl)-2-oxoethyl]-(4-nitrophenyl)sulfonylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 11827451 |
| Molecular Formula | C25H32N2O8S |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | tert-butyl (2S)-2-[[2-(4-methoxyphenyl)-2-oxoethyl]-(4-nitrophenyl)sulfonylamino]-4-methylpentanoate |
| SMILES | COc1ccc(C(=O)CN([C@@H](CC(C)C)C(=O)OC(C)(C)C)S(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C25H32N2O8S/c1-17(2)15-22(24(29)35-25(3,4)5)26(16-23(28)18-7-11-20(34-6)12-8-18)36(32,33)21-13-9-19(10-14-21)27(30)31/h7-14,17,22H,15-16H2,1-6H3/t22-/m0/s1 |
| InChIKey | GIWSMSZVMOGGTM-QFIPXVFZSA-N |
| XLogP | 4.23 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|