C31H35N3O7S — CID 146168210
tert-butyl (2S)-2-[[1-(4-methoxyphenyl)-3-methylindol-2-yl]-(4-nitrophenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 146168210) has the molecular formula C31H35N3O7S and a molecular weight of 593.70 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[1-(4-methoxyphenyl)-3-methylindol-2-yl]-(4-nitrophenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | tert-butyl (2S)-2-[[1-(4-methoxyphenyl)-3-methylindol-2-yl]-(4-nitrophenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 146168210 |
| Molecular Formula | C31H35N3O7S |
| Molecular Weight | 593.70 g/mol |
| Exact Mass | 593.22 |
| IUPAC Name | tert-butyl (2S)-2-[[1-(4-methoxyphenyl)-3-methylindol-2-yl]-(4-nitrophenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | COc1ccc(-n2c(N([C@H](C(=O)OC(C)(C)C)C(C)C)S(=O)(=O)c3ccc([N+](=O)[O-])cc3)c(C)c3ccccc32)cc1 |
| InChI | InChI=1S/C31H35N3O7S/c1-20(2)28(30(35)41-31(4,5)6)33(42(38,39)25-18-14-23(15-19-25)34(36)37)29-21(3)26-10-8-9-11-27(26)32(29)22-12-16-24(40-7)17-13-22/h8-20,28H,1-7H3/t28-/m0/s1 |
| InChIKey | BDZBUXVPKATDSM-NDEPHWFRSA-N |
| XLogP | 6.42 |
| TPSA | 120.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.70 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|