C21H25ClN2O7S — CID 22907176
2-[(6-chloro-1,3-benzodioxol-5-yl)methyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-4-methylpentanamide (PubChem CID 22907176) has the molecular formula C21H25ClN2O7S and a molecular weight of 484.96 g/mol. Its IUPAC name is 2-[(6-chloro-1,3-benzodioxol-5-yl)methyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-4-methylpentanamide.
| Compound Name | 2-[(6-chloro-1,3-benzodioxol-5-yl)methyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-4-methylpentanamide |
|---|---|
| PubChem CID | 22907176 |
| Molecular Formula | C21H25ClN2O7S |
| Molecular Weight | 484.96 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 2-[(6-chloro-1,3-benzodioxol-5-yl)methyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-4-methylpentanamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2cc3c(cc2Cl)OCO3)C(CC(C)C)C(=O)NO)cc1 |
| InChI | InChI=1S/C21H25ClN2O7S/c1-13(2)8-18(21(25)23-26)24(32(27,28)16-6-4-15(29-3)5-7-16)11-14-9-19-20(10-17(14)22)31-12-30-19/h4-7,9-10,13,18,26H,8,11-12H2,1-3H3,(H,23,25) |
| InChIKey | KHVHRBURABQJET-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.96 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|