C22H26N2O9S — CID 18337575
[(2R)-2-[1,3-benzodioxol-5-ylmethyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]-3-(hydroxyamino)-3-oxopropyl] acetate (PubChem CID 18337575) has the molecular formula C22H26N2O9S and a molecular weight of 494.52 g/mol. Its IUPAC name is [(2R)-2-[1,3-benzodioxol-5-ylmethyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]-3-(hydroxyamino)-3-oxopropyl] acetate.
| Compound Name | [(2R)-2-[1,3-benzodioxol-5-ylmethyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]-3-(hydroxyamino)-3-oxopropyl] acetate |
|---|---|
| PubChem CID | 18337575 |
| Molecular Formula | C22H26N2O9S |
| Molecular Weight | 494.52 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | [(2R)-2-[1,3-benzodioxol-5-ylmethyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]-3-(hydroxyamino)-3-oxopropyl] acetate |
| SMILES | COc1cc(C)c(S(=O)(=O)N(Cc2ccc3c(c2)OCO3)[C@H](COC(C)=O)C(=O)NO)c(C)c1 |
| InChI | InChI=1S/C22H26N2O9S/c1-13-7-17(30-4)8-14(2)21(13)34(28,29)24(18(22(26)23-27)11-31-15(3)25)10-16-5-6-19-20(9-16)33-12-32-19/h5-9,18,27H,10-12H2,1-4H3,(H,23,26)/t18-/m1/s1 |
| InChIKey | DETYMGNADQAGTH-GOSISDBHSA-N |
| XLogP | 1.67 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.52 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|