C21H27N3O9S2 — CID 56983173
(2R)-2-[[3-(1,3-benzodioxol-5-ylmethyl)-4-methoxy-2,6-dimethylphenyl]sulfonylamino]-N-hydroxy-3-(methanesulfonamido)propanamide (PubChem CID 56983173) has the molecular formula C21H27N3O9S2 and a molecular weight of 529.59 g/mol. Its IUPAC name is (2R)-2-[[3-(1,3-benzodioxol-5-ylmethyl)-4-methoxy-2,6-dimethylphenyl]sulfonylamino]-N-hydroxy-3-(methanesulfonamido)propanamide.
| Compound Name | (2R)-2-[[3-(1,3-benzodioxol-5-ylmethyl)-4-methoxy-2,6-dimethylphenyl]sulfonylamino]-N-hydroxy-3-(methanesulfonamido)propanamide |
|---|---|
| PubChem CID | 56983173 |
| Molecular Formula | C21H27N3O9S2 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | (2R)-2-[[3-(1,3-benzodioxol-5-ylmethyl)-4-methoxy-2,6-dimethylphenyl]sulfonylamino]-N-hydroxy-3-(methanesulfonamido)propanamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N[C@H](CNS(C)(=O)=O)C(=O)NO)c(C)c1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H27N3O9S2/c1-12-7-18(31-3)15(8-14-5-6-17-19(9-14)33-11-32-17)13(2)20(12)35(29,30)24-16(21(25)23-26)10-22-34(4,27)28/h5-7,9,16,22,24,26H,8,10-11H2,1-4H3,(H,23,25)/t16-/m1/s1 |
| InChIKey | URNQJEATRAFSPW-MRXNPFEDSA-N |
| XLogP | 0.33 |
| TPSA | 169.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|