C27H29N3O8S — CID 10209606
N-[(2R)-2-[1,3-benzodioxol-5-ylmethyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]-3-(hydroxyamino)-3-oxopropyl]benzamide (PubChem CID 10209606) has the molecular formula C27H29N3O8S and a molecular weight of 555.61 g/mol. Its IUPAC name is N-[(2R)-2-[1,3-benzodioxol-5-ylmethyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]-3-(hydroxyamino)-3-oxopropyl]benzamide.
| Compound Name | N-[(2R)-2-[1,3-benzodioxol-5-ylmethyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]-3-(hydroxyamino)-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 10209606 |
| Molecular Formula | C27H29N3O8S |
| Molecular Weight | 555.61 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | N-[(2R)-2-[1,3-benzodioxol-5-ylmethyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]-3-(hydroxyamino)-3-oxopropyl]benzamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N(Cc2ccc3c(c2)OCO3)[C@H](CNC(=O)c2ccccc2)C(=O)NO)c(C)c1 |
| InChI | InChI=1S/C27H29N3O8S/c1-17-11-21(36-3)12-18(2)25(17)39(34,35)30(15-19-9-10-23-24(13-19)38-16-37-23)22(27(32)29-33)14-28-26(31)20-7-5-4-6-8-20/h4-13,22,33H,14-16H2,1-3H3,(H,28,31)(H,29,32)/t22-/m1/s1 |
| InChIKey | GMPDXDYSVMPZGQ-JOCHJYFZSA-N |
| XLogP | 2.54 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.61 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|