C23H28N2O9S — CID 22596209
[2-[1,3-benzodioxol-5-ylmethyl-(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-3-(hydroxyamino)-3-oxopropyl] acetate (PubChem CID 22596209) has the molecular formula C23H28N2O9S and a molecular weight of 508.55 g/mol. Its IUPAC name is [2-[1,3-benzodioxol-5-ylmethyl-(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-3-(hydroxyamino)-3-oxopropyl] acetate.
| Compound Name | [2-[1,3-benzodioxol-5-ylmethyl-(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-3-(hydroxyamino)-3-oxopropyl] acetate |
|---|---|
| PubChem CID | 22596209 |
| Molecular Formula | C23H28N2O9S |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | [2-[1,3-benzodioxol-5-ylmethyl-(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-3-(hydroxyamino)-3-oxopropyl] acetate |
| SMILES | COc1cc(C)c(S(=O)(=O)N(Cc2ccc3c(c2)OCO3)C(COC(C)=O)C(=O)NO)c(C)c1C |
| InChI | InChI=1S/C23H28N2O9S/c1-13-8-20(31-5)14(2)15(3)22(13)35(29,30)25(18(23(27)24-28)11-32-16(4)26)10-17-6-7-19-21(9-17)34-12-33-19/h6-9,18,28H,10-12H2,1-5H3,(H,24,27) |
| InChIKey | HLVUCOFCNSJSPE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|