C26H33N3O8S — CID 22121978
1-[3-[[1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-(4-phenoxyphenyl)sulfonylamino]propanoyl]piperidine-4-carboxylic acid (PubChem CID 22121978) has the molecular formula C26H33N3O8S and a molecular weight of 547.63 g/mol. Its IUPAC name is 1-[3-[[1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-(4-phenoxyphenyl)sulfonylamino]propanoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[3-[[1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-(4-phenoxyphenyl)sulfonylamino]propanoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 22121978 |
| Molecular Formula | C26H33N3O8S |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | 1-[3-[[1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-(4-phenoxyphenyl)sulfonylamino]propanoyl]piperidine-4-carboxylic acid |
| SMILES | CC(C)C(C(=O)NO)N(CCC(=O)N1CCC(C(=O)O)CC1)S(=O)(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C26H33N3O8S/c1-18(2)24(25(31)27-34)29(17-14-23(30)28-15-12-19(13-16-28)26(32)33)38(35,36)22-10-8-21(9-11-22)37-20-6-4-3-5-7-20/h3-11,18-19,24,34H,12-17H2,1-2H3,(H,27,31)(H,32,33) |
| InChIKey | RCSKWULVKXJHQO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|