C22H30N2O8S2 — CID 87594138
(2S)-N-hydroxy-2-[2-methoxypropyl-[4-(4-methylsulfonylphenoxy)phenyl]sulfonylamino]-3-methylbutanamide (PubChem CID 87594138) has the molecular formula C22H30N2O8S2 and a molecular weight of 514.62 g/mol. Its IUPAC name is (2S)-N-hydroxy-2-[2-methoxypropyl-[4-(4-methylsulfonylphenoxy)phenyl]sulfonylamino]-3-methylbutanamide.
| Compound Name | (2S)-N-hydroxy-2-[2-methoxypropyl-[4-(4-methylsulfonylphenoxy)phenyl]sulfonylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 87594138 |
| Molecular Formula | C22H30N2O8S2 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | (2S)-N-hydroxy-2-[2-methoxypropyl-[4-(4-methylsulfonylphenoxy)phenyl]sulfonylamino]-3-methylbutanamide |
| SMILES | COC(C)CN([C@H](C(=O)NO)C(C)C)S(=O)(=O)c1ccc(Oc2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C22H30N2O8S2/c1-15(2)21(22(25)23-26)24(14-16(3)31-4)34(29,30)20-12-8-18(9-13-20)32-17-6-10-19(11-7-17)33(5,27)28/h6-13,15-16,21,26H,14H2,1-5H3,(H,23,25)/t16?,21-/m0/s1 |
| InChIKey | FNUIXCIMSFQEGD-MRNPHLECSA-N |
| XLogP | 2.44 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|