C23H32N4O7S2 — CID 59910371
(2R)-2-[[4-(benzenesulfonamido)phenyl]sulfonyl-(2-morpholin-4-ylethyl)amino]-N-hydroxy-3-methylbutanamide (PubChem CID 59910371) has the molecular formula C23H32N4O7S2 and a molecular weight of 540.66 g/mol. Its IUPAC name is (2R)-2-[[4-(benzenesulfonamido)phenyl]sulfonyl-(2-morpholin-4-ylethyl)amino]-N-hydroxy-3-methylbutanamide.
| Compound Name | (2R)-2-[[4-(benzenesulfonamido)phenyl]sulfonyl-(2-morpholin-4-ylethyl)amino]-N-hydroxy-3-methylbutanamide |
|---|---|
| PubChem CID | 59910371 |
| Molecular Formula | C23H32N4O7S2 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | (2R)-2-[[4-(benzenesulfonamido)phenyl]sulfonyl-(2-morpholin-4-ylethyl)amino]-N-hydroxy-3-methylbutanamide |
| SMILES | CC(C)[C@H](C(=O)NO)N(CCN1CCOCC1)S(=O)(=O)c1ccc(NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H32N4O7S2/c1-18(2)22(23(28)24-29)27(13-12-26-14-16-34-17-15-26)36(32,33)21-10-8-19(9-11-21)25-35(30,31)20-6-4-3-5-7-20/h3-11,18,22,25,29H,12-17H2,1-2H3,(H,24,28)/t22-/m1/s1 |
| InChIKey | VXQDXLUBRRZSSV-JOCHJYFZSA-N |
| XLogP | 1.34 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|