C28H40N4O6S — CID 18425185
4-butyl-N-[4-[[1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-(2-morpholin-4-ylethyl)sulfamoyl]phenyl]benzamide (PubChem CID 18425185) has the molecular formula C28H40N4O6S and a molecular weight of 560.72 g/mol. Its IUPAC name is 4-butyl-N-[4-[[1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-(2-morpholin-4-ylethyl)sulfamoyl]phenyl]benzamide.
| Compound Name | 4-butyl-N-[4-[[1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-(2-morpholin-4-ylethyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 18425185 |
| Molecular Formula | C28H40N4O6S |
| Molecular Weight | 560.72 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | 4-butyl-N-[4-[[1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-(2-morpholin-4-ylethyl)sulfamoyl]phenyl]benzamide |
| SMILES | CCCCc1ccc(C(=O)Nc2ccc(S(=O)(=O)N(CCN3CCOCC3)C(C(=O)NO)C(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H40N4O6S/c1-4-5-6-22-7-9-23(10-8-22)27(33)29-24-11-13-25(14-12-24)39(36,37)32(26(21(2)3)28(34)30-35)16-15-31-17-19-38-20-18-31/h7-14,21,26,35H,4-6,15-20H2,1-3H3,(H,29,33)(H,30,34) |
| InChIKey | XFGBIGFBGZRSJK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.72 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|