C22H36N2O4S2 — CID 59983829
S-[(2S)-2-[2-morpholin-4-ylethyl-(4-pentylphenyl)sulfonylamino]propyl] ethanethioate (PubChem CID 59983829) has the molecular formula C22H36N2O4S2 and a molecular weight of 456.67 g/mol. Its IUPAC name is S-[(2S)-2-[2-morpholin-4-ylethyl-(4-pentylphenyl)sulfonylamino]propyl] ethanethioate.
| Compound Name | S-[(2S)-2-[2-morpholin-4-ylethyl-(4-pentylphenyl)sulfonylamino]propyl] ethanethioate |
|---|---|
| PubChem CID | 59983829 |
| Molecular Formula | C22H36N2O4S2 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | S-[(2S)-2-[2-morpholin-4-ylethyl-(4-pentylphenyl)sulfonylamino]propyl] ethanethioate |
| SMILES | CCCCCc1ccc(S(=O)(=O)N(CCN2CCOCC2)[C@@H](C)CSC(C)=O)cc1 |
| InChI | InChI=1S/C22H36N2O4S2/c1-4-5-6-7-21-8-10-22(11-9-21)30(26,27)24(19(2)18-29-20(3)25)13-12-23-14-16-28-17-15-23/h8-11,19H,4-7,12-18H2,1-3H3/t19-/m0/s1 |
| InChIKey | OZRIHKKFIONWDE-IBGZPJMESA-N |
| XLogP | 3.41 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|