C27H38N4O6S — CID 23380543
N-[4-[[1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-(2-morpholin-4-ylethyl)sulfamoyl]phenyl]-4-propylbenzamide (PubChem CID 23380543) has the molecular formula C27H38N4O6S and a molecular weight of 546.69 g/mol. Its IUPAC name is N-[4-[[1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-(2-morpholin-4-ylethyl)sulfamoyl]phenyl]-4-propylbenzamide.
| Compound Name | N-[4-[[1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-(2-morpholin-4-ylethyl)sulfamoyl]phenyl]-4-propylbenzamide |
|---|---|
| PubChem CID | 23380543 |
| Molecular Formula | C27H38N4O6S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | N-[4-[[1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-(2-morpholin-4-ylethyl)sulfamoyl]phenyl]-4-propylbenzamide |
| SMILES | CCCc1ccc(C(=O)Nc2ccc(S(=O)(=O)N(CCN3CCOCC3)C(C(=O)NO)C(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H38N4O6S/c1-4-5-21-6-8-22(9-7-21)26(32)28-23-10-12-24(13-11-23)38(35,36)31(25(20(2)3)27(33)29-34)15-14-30-16-18-37-19-17-30/h6-13,20,25,34H,4-5,14-19H2,1-3H3,(H,28,32)(H,29,33) |
| InChIKey | NKEAGZFKNVGUFY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|