C23H30FN3O4S — CID 55905014
3-(diethylsulfamoyl)-4-fluoro-N-[4-(2-morpholin-4-ylethyl)phenyl]benzamide (PubChem CID 55905014) has the molecular formula C23H30FN3O4S and a molecular weight of 463.58 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-4-fluoro-N-[4-(2-morpholin-4-ylethyl)phenyl]benzamide.
| Compound Name | 3-(diethylsulfamoyl)-4-fluoro-N-[4-(2-morpholin-4-ylethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55905014 |
| Molecular Formula | C23H30FN3O4S |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 3-(diethylsulfamoyl)-4-fluoro-N-[4-(2-morpholin-4-ylethyl)phenyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)Nc2ccc(CCN3CCOCC3)cc2)ccc1F |
| InChI | InChI=1S/C23H30FN3O4S/c1-3-27(4-2)32(29,30)22-17-19(7-10-21(22)24)23(28)25-20-8-5-18(6-9-20)11-12-26-13-15-31-16-14-26/h5-10,17H,3-4,11-16H2,1-2H3,(H,25,28) |
| InChIKey | CLMSVSSMYHSMCN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |