C24H27N3O4 — CID 55905402
4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-[4-(2-morpholin-4-ylethyl)phenyl]benzamide (PubChem CID 55905402) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-[4-(2-morpholin-4-ylethyl)phenyl]benzamide.
| Compound Name | 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-[4-(2-morpholin-4-ylethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55905402 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-[4-(2-morpholin-4-ylethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(CCN2CCOCC2)cc1)c1ccc(CN2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C24H27N3O4/c28-22-9-10-23(29)27(22)17-19-1-5-20(6-2-19)24(30)25-21-7-3-18(4-8-21)11-12-26-13-15-31-16-14-26/h1-8H,9-17H2,(H,25,30) |
| InChIKey | JYIYOBLPHGGNSB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|