C19H26ClNO5S — CID 22644706
methyl 2-[(4-but-2-ynoxyphenyl)sulfonyl-(3-chloropropyl)amino]-3-methylbutanoate (PubChem CID 22644706) has the molecular formula C19H26ClNO5S and a molecular weight of 415.94 g/mol. Its IUPAC name is methyl 2-[(4-but-2-ynoxyphenyl)sulfonyl-(3-chloropropyl)amino]-3-methylbutanoate.
| Compound Name | methyl 2-[(4-but-2-ynoxyphenyl)sulfonyl-(3-chloropropyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 22644706 |
| Molecular Formula | C19H26ClNO5S |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | methyl 2-[(4-but-2-ynoxyphenyl)sulfonyl-(3-chloropropyl)amino]-3-methylbutanoate |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N(CCCCl)C(C(=O)OC)C(C)C)cc1 |
| InChI | InChI=1S/C19H26ClNO5S/c1-5-6-14-26-16-8-10-17(11-9-16)27(23,24)21(13-7-12-20)18(15(2)3)19(22)25-4/h8-11,15,18H,7,12-14H2,1-4H3 |
| InChIKey | ZAKIEBJDMAUZQO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|