C17H22O5S — CID 11336677
ethyl 2-(4-but-2-ynoxyphenyl)sulfonyl-3-methylbutanoate (PubChem CID 11336677) has the molecular formula C17H22O5S and a molecular weight of 338.43 g/mol. Its IUPAC name is ethyl 2-(4-but-2-ynoxyphenyl)sulfonyl-3-methylbutanoate.
| Compound Name | ethyl 2-(4-but-2-ynoxyphenyl)sulfonyl-3-methylbutanoate |
|---|---|
| PubChem CID | 11336677 |
| Molecular Formula | C17H22O5S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | ethyl 2-(4-but-2-ynoxyphenyl)sulfonyl-3-methylbutanoate |
| SMILES | CC#CCOc1ccc(S(=O)(=O)C(C(=O)OCC)C(C)C)cc1 |
| InChI | InChI=1S/C17H22O5S/c1-5-7-12-22-14-8-10-15(11-9-14)23(19,20)16(13(3)4)17(18)21-6-2/h8-11,13,16H,6,12H2,1-4H3 |
| InChIKey | GIGPOKYTUDTDFD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|