C18H24O5S — CID 129382603
(2R)-2-(4-but-2-ynoxyphenyl)sulfonyloctanoic acid (PubChem CID 129382603) has the molecular formula C18H24O5S and a molecular weight of 352.45 g/mol. Its IUPAC name is (2R)-2-(4-but-2-ynoxyphenyl)sulfonyloctanoic acid.
| Compound Name | (2R)-2-(4-but-2-ynoxyphenyl)sulfonyloctanoic acid |
|---|---|
| PubChem CID | 129382603 |
| Molecular Formula | C18H24O5S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (2R)-2-(4-but-2-ynoxyphenyl)sulfonyloctanoic acid |
| SMILES | CC#CCOc1ccc(S(=O)(=O)[C@H](CCCCCC)C(=O)O)cc1 |
| InChI | InChI=1S/C18H24O5S/c1-3-5-7-8-9-17(18(19)20)24(21,22)16-12-10-15(11-13-16)23-14-6-4-2/h10-13,17H,3,5,7-9,14H2,1-2H3,(H,19,20)/t17-/m1/s1 |
| InChIKey | NAMYGCWUFQUUPD-QGZVFWFLSA-N |
| XLogP | 3.29 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|