C18H25NO5S — CID 141027126
(2R)-2-[(4-but-2-ynoxyphenyl)sulfonyl-propylamino]-3-methylbutanoic acid (PubChem CID 141027126) has the molecular formula C18H25NO5S and a molecular weight of 367.47 g/mol. Its IUPAC name is (2R)-2-[(4-but-2-ynoxyphenyl)sulfonyl-propylamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[(4-but-2-ynoxyphenyl)sulfonyl-propylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 141027126 |
| Molecular Formula | C18H25NO5S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (2R)-2-[(4-but-2-ynoxyphenyl)sulfonyl-propylamino]-3-methylbutanoic acid |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N(CCC)[C@@H](C(=O)O)C(C)C)cc1 |
| InChI | InChI=1S/C18H25NO5S/c1-5-7-13-24-15-8-10-16(11-9-15)25(22,23)19(12-6-2)17(14(3)4)18(20)21/h8-11,14,17H,6,12-13H2,1-4H3,(H,20,21)/t17-/m1/s1 |
| InChIKey | RUJJFQMLBBMEBF-QGZVFWFLSA-N |
| XLogP | 2.60 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|