C22H33ClN2O5S — CID 57206438
diethylamino 2-[(4-but-2-ynoxyphenyl)sulfonyl-(3-chloropropyl)amino]-3-methylbutanoate (PubChem CID 57206438) has the molecular formula C22H33ClN2O5S and a molecular weight of 473.04 g/mol. Its IUPAC name is diethylamino 2-[(4-but-2-ynoxyphenyl)sulfonyl-(3-chloropropyl)amino]-3-methylbutanoate.
| Compound Name | diethylamino 2-[(4-but-2-ynoxyphenyl)sulfonyl-(3-chloropropyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 57206438 |
| Molecular Formula | C22H33ClN2O5S |
| Molecular Weight | 473.04 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | diethylamino 2-[(4-but-2-ynoxyphenyl)sulfonyl-(3-chloropropyl)amino]-3-methylbutanoate |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N(CCCCl)C(C(=O)ON(CC)CC)C(C)C)cc1 |
| InChI | InChI=1S/C22H33ClN2O5S/c1-6-9-17-29-19-11-13-20(14-12-19)31(27,28)25(16-10-15-23)21(18(4)5)22(26)30-24(7-2)8-3/h11-14,18,21H,7-8,10,15-17H2,1-5H3 |
| InChIKey | RVPWKNUUXZOHQP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.04 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|