C18H23NO5S — CID 86587114
[(4-but-2-ynoxyphenyl)sulfonyl-methylamino] cyclohexanecarboxylate (PubChem CID 86587114) has the molecular formula C18H23NO5S and a molecular weight of 365.45 g/mol. Its IUPAC name is [(4-but-2-ynoxyphenyl)sulfonyl-methylamino] cyclohexanecarboxylate.
| Compound Name | [(4-but-2-ynoxyphenyl)sulfonyl-methylamino] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 86587114 |
| Molecular Formula | C18H23NO5S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | [(4-but-2-ynoxyphenyl)sulfonyl-methylamino] cyclohexanecarboxylate |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N(C)OC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C18H23NO5S/c1-3-4-14-23-16-10-12-17(13-11-16)25(21,22)19(2)24-18(20)15-8-6-5-7-9-15/h10-13,15H,5-9,14H2,1-2H3 |
| InChIKey | BYXLQBFDSXNGFO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|