C22H24ClNO5S — CID 54493564
[[4-[3-(4-chlorophenyl)prop-2-ynoxy]phenyl]sulfonyl-methylamino] 3,3-dimethylbutanoate (PubChem CID 54493564) has the molecular formula C22H24ClNO5S and a molecular weight of 449.96 g/mol. Its IUPAC name is [[4-[3-(4-chlorophenyl)prop-2-ynoxy]phenyl]sulfonyl-methylamino] 3,3-dimethylbutanoate.
| Compound Name | [[4-[3-(4-chlorophenyl)prop-2-ynoxy]phenyl]sulfonyl-methylamino] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 54493564 |
| Molecular Formula | C22H24ClNO5S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | [[4-[3-(4-chlorophenyl)prop-2-ynoxy]phenyl]sulfonyl-methylamino] 3,3-dimethylbutanoate |
| SMILES | CN(OC(=O)CC(C)(C)C)S(=O)(=O)c1ccc(OCC#Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H24ClNO5S/c1-22(2,3)16-21(25)29-24(4)30(26,27)20-13-11-19(12-14-20)28-15-5-6-17-7-9-18(23)10-8-17/h7-14H,15-16H2,1-4H3 |
| InChIKey | XXMHSFFWORCOHW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|