C24H21BrN2O6S — CID 23506744
5-bromo-N-hydroxy-2-[[4-[3-(3-hydroxyphenyl)prop-2-ynoxy]phenyl]sulfonyl-methylamino]-3-methylbenzamide (PubChem CID 23506744) has the molecular formula C24H21BrN2O6S and a molecular weight of 545.41 g/mol. Its IUPAC name is 5-bromo-N-hydroxy-2-[[4-[3-(3-hydroxyphenyl)prop-2-ynoxy]phenyl]sulfonyl-methylamino]-3-methylbenzamide.
| Compound Name | 5-bromo-N-hydroxy-2-[[4-[3-(3-hydroxyphenyl)prop-2-ynoxy]phenyl]sulfonyl-methylamino]-3-methylbenzamide |
|---|---|
| PubChem CID | 23506744 |
| Molecular Formula | C24H21BrN2O6S |
| Molecular Weight | 545.41 g/mol |
| Exact Mass | 544.03 |
| IUPAC Name | 5-bromo-N-hydroxy-2-[[4-[3-(3-hydroxyphenyl)prop-2-ynoxy]phenyl]sulfonyl-methylamino]-3-methylbenzamide |
| SMILES | Cc1cc(Br)cc(C(=O)NO)c1N(C)S(=O)(=O)c1ccc(OCC#Cc2cccc(O)c2)cc1 |
| InChI | InChI=1S/C24H21BrN2O6S/c1-16-13-18(25)15-22(24(29)26-30)23(16)27(2)34(31,32)21-10-8-20(9-11-21)33-12-4-6-17-5-3-7-19(28)14-17/h3,5,7-11,13-15,28,30H,12H2,1-2H3,(H,26,29) |
| InChIKey | PGJRXBJAUPCVAN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|