C23H26BrNO5S — CID 101161784
methyl 5-bromo-2-[(4-hept-2-ynoxyphenyl)sulfonyl-methylamino]-3-methylbenzoate (PubChem CID 101161784) has the molecular formula C23H26BrNO5S and a molecular weight of 508.43 g/mol. Its IUPAC name is methyl 5-bromo-2-[(4-hept-2-ynoxyphenyl)sulfonyl-methylamino]-3-methylbenzoate.
| Compound Name | methyl 5-bromo-2-[(4-hept-2-ynoxyphenyl)sulfonyl-methylamino]-3-methylbenzoate |
|---|---|
| PubChem CID | 101161784 |
| Molecular Formula | C23H26BrNO5S |
| Molecular Weight | 508.43 g/mol |
| Exact Mass | 507.07 |
| IUPAC Name | methyl 5-bromo-2-[(4-hept-2-ynoxyphenyl)sulfonyl-methylamino]-3-methylbenzoate |
| SMILES | CCCCC#CCOc1ccc(S(=O)(=O)N(C)c2c(C)cc(Br)cc2C(=O)OC)cc1 |
| InChI | InChI=1S/C23H26BrNO5S/c1-5-6-7-8-9-14-30-19-10-12-20(13-11-19)31(27,28)25(3)22-17(2)15-18(24)16-21(22)23(26)29-4/h10-13,15-16H,5-7,14H2,1-4H3 |
| InChIKey | ONTIPDIWBJVPLU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.43 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|