C27H35BrN2O6S — CID 68882366
1-[(4-bromophenyl)methyl]-4-(4-oct-2-ynoxyphenyl)sulfonylpiperidine-4-carboxylic acid;hydroxylamine (PubChem CID 68882366) has the molecular formula C27H35BrN2O6S and a molecular weight of 595.56 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-4-(4-oct-2-ynoxyphenyl)sulfonylpiperidine-4-carboxylic acid;hydroxylamine.
| Compound Name | 1-[(4-bromophenyl)methyl]-4-(4-oct-2-ynoxyphenyl)sulfonylpiperidine-4-carboxylic acid;hydroxylamine |
|---|---|
| PubChem CID | 68882366 |
| Molecular Formula | C27H35BrN2O6S |
| Molecular Weight | 595.56 g/mol |
| Exact Mass | 594.14 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-4-(4-oct-2-ynoxyphenyl)sulfonylpiperidine-4-carboxylic acid;hydroxylamine |
| SMILES | CCCCCC#CCOc1ccc(S(=O)(=O)C2(C(=O)O)CCN(Cc3ccc(Br)cc3)CC2)cc1.NO |
| InChI | InChI=1S/C27H32BrNO5S.H3NO/c1-2-3-4-5-6-7-20-34-24-12-14-25(15-13-24)35(32,33)27(26(30)31)16-18-29(19-17-27)21-22-8-10-23(28)11-9-22;1-2/h8-15H,2-5,16-21H2,1H3,(H,30,31);2H,1H2 |
| InChIKey | KBOPIHBHJGPBNE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|