C27H31BrN2O6S — CID 11399167
1-[(4-bromophenyl)methyl]-4-[4-(4-morpholin-4-ylbut-2-ynoxy)phenyl]sulfonylpiperidine-4-carboxylic acid (PubChem CID 11399167) has the molecular formula C27H31BrN2O6S and a molecular weight of 591.52 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-4-[4-(4-morpholin-4-ylbut-2-ynoxy)phenyl]sulfonylpiperidine-4-carboxylic acid.
| Compound Name | 1-[(4-bromophenyl)methyl]-4-[4-(4-morpholin-4-ylbut-2-ynoxy)phenyl]sulfonylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 11399167 |
| Molecular Formula | C27H31BrN2O6S |
| Molecular Weight | 591.52 g/mol |
| Exact Mass | 590.11 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-4-[4-(4-morpholin-4-ylbut-2-ynoxy)phenyl]sulfonylpiperidine-4-carboxylic acid |
| SMILES | O=C(O)C1(S(=O)(=O)c2ccc(OCC#CCN3CCOCC3)cc2)CCN(Cc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C27H31BrN2O6S/c28-23-5-3-22(4-6-23)21-30-14-11-27(12-15-30,26(31)32)37(33,34)25-9-7-24(8-10-25)36-18-2-1-13-29-16-19-35-20-17-29/h3-10H,11-21H2,(H,31,32) |
| InChIKey | ALLUYHHJTXWEBJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|