C25H28N2O7S — CID 11214204
methyl 4-[[4-(4-but-2-ynoxyphenyl)sulfonyl-4-(hydroxycarbamoyl)piperidin-1-yl]methyl]benzoate (PubChem CID 11214204) has the molecular formula C25H28N2O7S and a molecular weight of 500.57 g/mol. Its IUPAC name is methyl 4-[[4-(4-but-2-ynoxyphenyl)sulfonyl-4-(hydroxycarbamoyl)piperidin-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[4-(4-but-2-ynoxyphenyl)sulfonyl-4-(hydroxycarbamoyl)piperidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 11214204 |
| Molecular Formula | C25H28N2O7S |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | methyl 4-[[4-(4-but-2-ynoxyphenyl)sulfonyl-4-(hydroxycarbamoyl)piperidin-1-yl]methyl]benzoate |
| SMILES | CC#CCOc1ccc(S(=O)(=O)C2(C(=O)NO)CCN(Cc3ccc(C(=O)OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H28N2O7S/c1-3-4-17-34-21-9-11-22(12-10-21)35(31,32)25(24(29)26-30)13-15-27(16-14-25)18-19-5-7-20(8-6-19)23(28)33-2/h5-12,30H,13-18H2,1-2H3,(H,26,29) |
| InChIKey | IYVCKUKIYDRRAJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|