C31H31ClN2O7S — CID 23513896
1-benzoyl-4-[(4-but-2-ynoxyphenyl)sulfonylmethyl]-N-hydroxypiperidine-4-carboxamide;benzoyl chloride (PubChem CID 23513896) has the molecular formula C31H31ClN2O7S and a molecular weight of 611.12 g/mol. Its IUPAC name is 1-benzoyl-4-[(4-but-2-ynoxyphenyl)sulfonylmethyl]-N-hydroxypiperidine-4-carboxamide;benzoyl chloride.
| Compound Name | 1-benzoyl-4-[(4-but-2-ynoxyphenyl)sulfonylmethyl]-N-hydroxypiperidine-4-carboxamide;benzoyl chloride |
|---|---|
| PubChem CID | 23513896 |
| Molecular Formula | C31H31ClN2O7S |
| Molecular Weight | 611.12 g/mol |
| Exact Mass | 610.15 |
| IUPAC Name | 1-benzoyl-4-[(4-but-2-ynoxyphenyl)sulfonylmethyl]-N-hydroxypiperidine-4-carboxamide;benzoyl chloride |
| SMILES | CC#CCOc1ccc(S(=O)(=O)CC2(C(=O)NO)CCN(C(=O)c3ccccc3)CC2)cc1.O=C(Cl)c1ccccc1 |
| InChI | InChI=1S/C24H26N2O6S.C7H5ClO/c1-2-3-17-32-20-9-11-21(12-10-20)33(30,31)18-24(23(28)25-29)13-15-26(16-14-24)22(27)19-7-5-4-6-8-19;8-7(9)6-4-2-1-3-5-6/h4-12,29H,13-18H2,1H3,(H,25,28);1-5H |
| InChIKey | GCDMNKLUOKEDOM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.12 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|