C23H28N2O5S2 — CID 87612234
3-benzylsulfanyl-2-[(4-but-2-ynoxyphenyl)sulfonylmethylamino]-N-hydroxy-3-methylbutanamide (PubChem CID 87612234) has the molecular formula C23H28N2O5S2 and a molecular weight of 476.62 g/mol. Its IUPAC name is 3-benzylsulfanyl-2-[(4-but-2-ynoxyphenyl)sulfonylmethylamino]-N-hydroxy-3-methylbutanamide.
| Compound Name | 3-benzylsulfanyl-2-[(4-but-2-ynoxyphenyl)sulfonylmethylamino]-N-hydroxy-3-methylbutanamide |
|---|---|
| PubChem CID | 87612234 |
| Molecular Formula | C23H28N2O5S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 3-benzylsulfanyl-2-[(4-but-2-ynoxyphenyl)sulfonylmethylamino]-N-hydroxy-3-methylbutanamide |
| SMILES | CC#CCOc1ccc(S(=O)(=O)CNC(C(=O)NO)C(C)(C)SCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H28N2O5S2/c1-4-5-15-30-19-11-13-20(14-12-19)32(28,29)17-24-21(22(26)25-27)23(2,3)31-16-18-9-7-6-8-10-18/h6-14,21,24,27H,15-17H2,1-3H3,(H,25,26) |
| InChIKey | NRQDEOZVRMFAJB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|