C22H27N3O5S2 — CID 87612013
2-[(4-but-2-ynoxyphenyl)sulfonylmethylamino]-N-hydroxy-3-methyl-3-(pyridin-3-ylmethylsulfanyl)butanamide (PubChem CID 87612013) has the molecular formula C22H27N3O5S2 and a molecular weight of 477.61 g/mol. Its IUPAC name is 2-[(4-but-2-ynoxyphenyl)sulfonylmethylamino]-N-hydroxy-3-methyl-3-(pyridin-3-ylmethylsulfanyl)butanamide.
| Compound Name | 2-[(4-but-2-ynoxyphenyl)sulfonylmethylamino]-N-hydroxy-3-methyl-3-(pyridin-3-ylmethylsulfanyl)butanamide |
|---|---|
| PubChem CID | 87612013 |
| Molecular Formula | C22H27N3O5S2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 2-[(4-but-2-ynoxyphenyl)sulfonylmethylamino]-N-hydroxy-3-methyl-3-(pyridin-3-ylmethylsulfanyl)butanamide |
| SMILES | CC#CCOc1ccc(S(=O)(=O)CNC(C(=O)NO)C(C)(C)SCc2cccnc2)cc1 |
| InChI | InChI=1S/C22H27N3O5S2/c1-4-5-13-30-18-8-10-19(11-9-18)32(28,29)16-24-20(21(26)25-27)22(2,3)31-15-17-7-6-12-23-14-17/h6-12,14,20,24,27H,13,15-16H2,1-3H3,(H,25,26) |
| InChIKey | ATCGIHMBMVZTKH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|