C21H24N4O6S2 — CID 15462317
(2S)-N-hydroxy-3-methyl-3-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]-2-[(4-pyridin-4-yloxyphenyl)sulfonylamino]butanamide (PubChem CID 15462317) has the molecular formula C21H24N4O6S2 and a molecular weight of 492.58 g/mol. Its IUPAC name is (2S)-N-hydroxy-3-methyl-3-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]-2-[(4-pyridin-4-yloxyphenyl)sulfonylamino]butanamide.
| Compound Name | (2S)-N-hydroxy-3-methyl-3-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]-2-[(4-pyridin-4-yloxyphenyl)sulfonylamino]butanamide |
|---|---|
| PubChem CID | 15462317 |
| Molecular Formula | C21H24N4O6S2 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | (2S)-N-hydroxy-3-methyl-3-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]-2-[(4-pyridin-4-yloxyphenyl)sulfonylamino]butanamide |
| SMILES | Cc1cc(CSC(C)(C)[C@@H](NS(=O)(=O)c2ccc(Oc3ccncc3)cc2)C(=O)NO)no1 |
| InChI | InChI=1S/C21H24N4O6S2/c1-14-12-15(24-31-14)13-32-21(2,3)19(20(26)23-27)25-33(28,29)18-6-4-16(5-7-18)30-17-8-10-22-11-9-17/h4-12,19,25,27H,13H2,1-3H3,(H,23,26)/t19-/m0/s1 |
| InChIKey | KSISGYBKHIXSNN-IBGZPJMESA-N |
| XLogP | 3.03 |
| TPSA | 143.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|