C21H24BrN5O5S2 — CID 73087993
2-[[4-(4-bromophenoxy)phenyl]sulfonylamino]-N-hydroxy-3-methyl-3-[(4-methyl-1,2,4-triazol-3-yl)methylsulfanyl]butanamide (PubChem CID 73087993) has the molecular formula C21H24BrN5O5S2 and a molecular weight of 570.49 g/mol. Its IUPAC name is 2-[[4-(4-bromophenoxy)phenyl]sulfonylamino]-N-hydroxy-3-methyl-3-[(4-methyl-1,2,4-triazol-3-yl)methylsulfanyl]butanamide.
| Compound Name | 2-[[4-(4-bromophenoxy)phenyl]sulfonylamino]-N-hydroxy-3-methyl-3-[(4-methyl-1,2,4-triazol-3-yl)methylsulfanyl]butanamide |
|---|---|
| PubChem CID | 73087993 |
| Molecular Formula | C21H24BrN5O5S2 |
| Molecular Weight | 570.49 g/mol |
| Exact Mass | 569.04 |
| IUPAC Name | 2-[[4-(4-bromophenoxy)phenyl]sulfonylamino]-N-hydroxy-3-methyl-3-[(4-methyl-1,2,4-triazol-3-yl)methylsulfanyl]butanamide |
| SMILES | Cn1cnnc1CSC(C)(C)C(NS(=O)(=O)c1ccc(Oc2ccc(Br)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C21H24BrN5O5S2/c1-21(2,33-12-18-24-23-13-27(18)3)19(20(28)25-29)26-34(30,31)17-10-8-16(9-11-17)32-15-6-4-14(22)5-7-15/h4-11,13,19,26,29H,12H2,1-3H3,(H,25,28) |
| InChIKey | LLDTYWLHQRPASJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|