C14H20BrNO5S2 — CID 67605192
(2S)-2-[(4-bromophenyl)sulfonylamino]-3-(2-hydroxypropylsulfanyl)-3-methylbutanoic acid (PubChem CID 67605192) has the molecular formula C14H20BrNO5S2 and a molecular weight of 426.35 g/mol. Its IUPAC name is (2S)-2-[(4-bromophenyl)sulfonylamino]-3-(2-hydroxypropylsulfanyl)-3-methylbutanoic acid.
| Compound Name | (2S)-2-[(4-bromophenyl)sulfonylamino]-3-(2-hydroxypropylsulfanyl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 67605192 |
| Molecular Formula | C14H20BrNO5S2 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | (2S)-2-[(4-bromophenyl)sulfonylamino]-3-(2-hydroxypropylsulfanyl)-3-methylbutanoic acid |
| SMILES | CC(O)CSC(C)(C)[C@@H](NS(=O)(=O)c1ccc(Br)cc1)C(=O)O |
| InChI | InChI=1S/C14H20BrNO5S2/c1-9(17)8-22-14(2,3)12(13(18)19)16-23(20,21)11-6-4-10(15)5-7-11/h4-7,9,12,16-17H,8H2,1-3H3,(H,18,19)/t9?,12-/m0/s1 |
| InChIKey | LIBAWWXOMNVTDJ-ACGXKRRESA-N |
| XLogP | 2.07 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |