C30H26N2O2 — CID 42429960
N-[(4-but-2-ynoxyphenyl)methyl]-4-phenyl-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 42429960) has the molecular formula C30H26N2O2 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[(4-but-2-ynoxyphenyl)methyl]-4-phenyl-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | N-[(4-but-2-ynoxyphenyl)methyl]-4-phenyl-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 42429960 |
| Molecular Formula | C30H26N2O2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | N-[(4-but-2-ynoxyphenyl)methyl]-4-phenyl-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | CC#CCOc1ccc(CN(Cc2cccnc2)C(=O)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H26N2O2/c1-2-3-20-34-29-17-11-24(12-18-29)22-32(23-25-8-7-19-31-21-25)30(33)28-15-13-27(14-16-28)26-9-5-4-6-10-26/h4-19,21H,20,22-23H2,1H3 |
| InChIKey | ABCAFUMKOZACJB-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|