C27H25N3O3 — CID 42277782
N-[(4-but-2-ynoxyphenyl)methyl]-2-[(1S)-3-oxo-1,2-dihydroisoindol-1-yl]-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 42277782) has the molecular formula C27H25N3O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is N-[(4-but-2-ynoxyphenyl)methyl]-2-[(1S)-3-oxo-1,2-dihydroisoindol-1-yl]-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | N-[(4-but-2-ynoxyphenyl)methyl]-2-[(1S)-3-oxo-1,2-dihydroisoindol-1-yl]-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 42277782 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-[(4-but-2-ynoxyphenyl)methyl]-2-[(1S)-3-oxo-1,2-dihydroisoindol-1-yl]-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | CC#CCOc1ccc(CN(Cc2cccnc2)C(=O)C[C@@H]2NC(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C27H25N3O3/c1-2-3-15-33-22-12-10-20(11-13-22)18-30(19-21-7-6-14-28-17-21)26(31)16-25-23-8-4-5-9-24(23)27(32)29-25/h4-14,17,25H,15-16,18-19H2,1H3,(H,29,32)/t25-/m0/s1 |
| InChIKey | NBKRDKIDBJSPFG-VWLOTQADSA-N |
| XLogP | 3.89 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|