C28H25FN2O3 — CID 42248306
N-[[4-[(4-fluorophenyl)methoxy]phenyl]methyl]-3-methoxy-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 42248306) has the molecular formula C28H25FN2O3 and a molecular weight of 456.52 g/mol. Its IUPAC name is N-[[4-[(4-fluorophenyl)methoxy]phenyl]methyl]-3-methoxy-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | N-[[4-[(4-fluorophenyl)methoxy]phenyl]methyl]-3-methoxy-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 42248306 |
| Molecular Formula | C28H25FN2O3 |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-[[4-[(4-fluorophenyl)methoxy]phenyl]methyl]-3-methoxy-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | COc1cccc(C(=O)N(Cc2ccc(OCc3ccc(F)cc3)cc2)Cc2cccnc2)c1 |
| InChI | InChI=1S/C28H25FN2O3/c1-33-27-6-2-5-24(16-27)28(32)31(19-23-4-3-15-30-17-23)18-21-9-13-26(14-10-21)34-20-22-7-11-25(29)12-8-22/h2-17H,18-20H2,1H3 |
| InChIKey | KRTCIDVITZGKNH-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |