C24H24FN3O3 — CID 55770583
N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-3-(pyridin-3-ylmethoxy)benzamide (PubChem CID 55770583) has the molecular formula C24H24FN3O3 and a molecular weight of 421.47 g/mol. Its IUPAC name is N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-3-(pyridin-3-ylmethoxy)benzamide.
| Compound Name | N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-3-(pyridin-3-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 55770583 |
| Molecular Formula | C24H24FN3O3 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-3-(pyridin-3-ylmethoxy)benzamide |
| SMILES | CCN(CC(=O)NCc1ccc(F)cc1)C(=O)c1cccc(OCc2cccnc2)c1 |
| InChI | InChI=1S/C24H24FN3O3/c1-2-28(16-23(29)27-15-18-8-10-21(25)11-9-18)24(30)20-6-3-7-22(13-20)31-17-19-5-4-12-26-14-19/h3-14H,2,15-17H2,1H3,(H,27,29) |
| InChIKey | QYYQQGDAWJFJIR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |