C26H20Cl2N2O — CID 168853807
N-[(3,5-dichlorophenyl)methyl]-3-phenyl-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 168853807) has the molecular formula C26H20Cl2N2O and a molecular weight of 447.37 g/mol. Its IUPAC name is N-[(3,5-dichlorophenyl)methyl]-3-phenyl-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | N-[(3,5-dichlorophenyl)methyl]-3-phenyl-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 168853807 |
| Molecular Formula | C26H20Cl2N2O |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | N-[(3,5-dichlorophenyl)methyl]-3-phenyl-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | O=C(c1cccc(-c2ccccc2)c1)N(Cc1cccnc1)Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C26H20Cl2N2O/c27-24-12-20(13-25(28)15-24)18-30(17-19-6-5-11-29-16-19)26(31)23-10-4-9-22(14-23)21-7-2-1-3-8-21/h1-16H,17-18H2 |
| InChIKey | SYPXLIXHLGQPSE-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |