C23H24N2O3S — CID 39738224
N-[(4-ethylphenyl)methyl]-3-methylsulfonyl-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 39738224) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is N-[(4-ethylphenyl)methyl]-3-methylsulfonyl-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | N-[(4-ethylphenyl)methyl]-3-methylsulfonyl-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 39738224 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N-[(4-ethylphenyl)methyl]-3-methylsulfonyl-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | CCc1ccc(CN(Cc2cccnc2)C(=O)c2cccc(S(C)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C23H24N2O3S/c1-3-18-9-11-19(12-10-18)16-25(17-20-6-5-13-24-15-20)23(26)21-7-4-8-22(14-21)29(2,27)28/h4-15H,3,16-17H2,1-2H3 |
| InChIKey | XZDRJXVXDKQATK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |