C20H13Cl2F3N2O — CID 168853794
N-[(2,4-dichlorophenyl)methyl]-3,4,5-trifluoro-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 168853794) has the molecular formula C20H13Cl2F3N2O and a molecular weight of 425.24 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-3,4,5-trifluoro-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-3,4,5-trifluoro-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 168853794 |
| Molecular Formula | C20H13Cl2F3N2O |
| Molecular Weight | 425.24 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-3,4,5-trifluoro-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | O=C(c1cc(F)c(F)c(F)c1)N(Cc1cccnc1)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H13Cl2F3N2O/c21-15-4-3-13(16(22)8-15)11-27(10-12-2-1-5-26-9-12)20(28)14-6-17(23)19(25)18(24)7-14/h1-9H,10-11H2 |
| InChIKey | YPRVSTOCEAZIPE-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.24 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|