C19H20Cl2N2O2 — CID 168853730
N-[(2,4-dichlorophenyl)methyl]-N-(pyridin-3-ylmethyl)oxane-4-carboxamide (PubChem CID 168853730) has the molecular formula C19H20Cl2N2O2 and a molecular weight of 379.29 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-N-(pyridin-3-ylmethyl)oxane-4-carboxamide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-N-(pyridin-3-ylmethyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 168853730 |
| Molecular Formula | C19H20Cl2N2O2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-N-(pyridin-3-ylmethyl)oxane-4-carboxamide |
| SMILES | O=C(C1CCOCC1)N(Cc1cccnc1)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H20Cl2N2O2/c20-17-4-3-16(18(21)10-17)13-23(12-14-2-1-7-22-11-14)19(24)15-5-8-25-9-6-15/h1-4,7,10-11,15H,5-6,8-9,12-13H2 |
| InChIKey | KMMPSFFVMZKOEL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |